CAS 299441-52-4 is the registry number for N-(4-(2-Amino-1,3-thiazol-4-yl)phenyl)benzamide. Offered by: TRC. Available pack sizes: 500mg.
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzamide (CAS 299441-52-4) is a chemical compound with the molecular formula C16H13N3OS and a molecular weight of 295.4 g/mol. IUPAC name: N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzamide. InChIKey: WNMRWBLANCRRGL-UHFFFAOYSA-N.
| Molecular formula | C16H13N3OS |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]benzamide |
| InChIKey | WNMRWBLANCRRGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C3=CSC(=N3)N |
Computed by PubChem (NCBI)