CAS 138147-16-7 is the registry number for Methyl 2-Deoxy-D-erythropentafuranose 5-(2,2-Dimethylpropanoate). Offered by: TRC. Available pack sizes: 10g.
[(2R,3S)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (CAS 138147-16-7) is a chemical compound with the molecular formula C11H20O5 and a molecular weight of 232.27 g/mol. IUPAC name: [(2R,3S)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate. InChIKey: LVXNBYHAAHVEJL-ZQTLJVIJSA-N.
| Molecular formula | C11H20O5 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | [(2R,3S)-3-hydroxy-5-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| InChIKey | LVXNBYHAAHVEJL-ZQTLJVIJSA-N |
| SMILES | CC(C)(C)C(=O)OC[C@@H]1[C@H](CC(O1)OC)O |
Computed by PubChem (NCBI)