Products 2649511-20-4
CAS 2649511-20-4 is the registry number for Methyl 4-((4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl)butanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate (CAS 2649511-20-4) is a chemical compound with the molecular formula C11H20O5 and a molecular weight of 232.27 g/mol. IUPAC name: methyl 4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate. InChIKey: HLVMKHVPRFGNHY-BDAKNGLRSA-N.
| Molecular formula | C11H20O5 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | methyl 4-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]butanoate |
| InChIKey | HLVMKHVPRFGNHY-BDAKNGLRSA-N |
| SMILES | CC1(O[C@@H]([C@@H](O1)CO)CCCC(=O)OC)C |
Computed by PubChem (NCBI)