CAS 138149-96-9 is the registry number for 1,3-Dihydro-N-nitro-1,3-dioxo-2H-isoindole-2-carboximidothioic acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
Methyl (2Z)-N-nitro-1,3-dioxoisoindole-2-carboximidothioate (CAS 138149-96-9) is a chemical compound with the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. IUPAC name: methyl (2Z)-N-nitro-1,3-dioxoisoindole-2-carboximidothioate. InChIKey: LVRHKKSAXKLFDG-KHPPLWFESA-N.
| Molecular formula | C10H7N3O4S |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | methyl (2Z)-N-nitro-1,3-dioxoisoindole-2-carboximidothioate |
| InChIKey | LVRHKKSAXKLFDG-KHPPLWFESA-N |
| SMILES | CS/C(=N\[N+](=O)[O-])/N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)