CAS 886496-56-6 is the registry number for 2-((4-Nitrophenyl)amino)thiazole-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4-nitroanilino)-1,3-thiazole-4-carboxylic acid (CAS 886496-56-6) is a chemical compound with the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. IUPAC name: 2-(4-nitroanilino)-1,3-thiazole-4-carboxylic acid. InChIKey: PGLWAUKTPVYTHD-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4S |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | 2-(4-nitroanilino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | PGLWAUKTPVYTHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC(=CS2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)