CAS 1381929-27-6 is the registry number for (S)-2-(2,4-Dichloro-5-fluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2,4-dichloro-5-fluorophenyl)pyrrolidine (CAS 1381929-27-6) is a chemical compound with the molecular formula C10H10Cl2FN and a molecular weight of 234.09 g/mol. IUPAC name: (2S)-2-(2,4-dichloro-5-fluorophenyl)pyrrolidine. InChIKey: CRUYFXMBNOTTNI-JTQLQIEISA-N.
| Molecular formula | C10H10Cl2FN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | (2S)-2-(2,4-dichloro-5-fluorophenyl)pyrrolidine |
| InChIKey | CRUYFXMBNOTTNI-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=C(C=C2Cl)Cl)F |
Computed by PubChem (NCBI)