CAS 1185099-31-3 is the registry number for 1-(Chloromethyl)-7-fluoro-3,4-dihydroisoquinoline hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-(chloromethyl)-7-fluoro-3,4-dihydroisoquinoline;hydrochloride (CAS 1185099-31-3) is a chemical compound with the molecular formula C10H10Cl2FN and a molecular weight of 234.09 g/mol. IUPAC name: 1-(chloromethyl)-7-fluoro-3,4-dihydroisoquinoline;hydrochloride. InChIKey: GBKVMQIWPWPWNC-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2FN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 1-(chloromethyl)-7-fluoro-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | GBKVMQIWPWPWNC-UHFFFAOYSA-N |
| SMILES | C1CN=C(C2=C1C=CC(=C2)F)CCl.Cl |
Computed by PubChem (NCBI)