Products 1381929-36-7
CAS 1381929-36-7 appears in our catalog under these names: (S)-2-(3-Methoxyphenyl)pyrrolidine hydrochloride, 95%, (S)–2–(3–Methoxyphenyl)pyrrolidine hydrochloride, (S)-2-(3-Methoxyphenyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 100mg, 1g, 50mg, 25mg.
(2S)-2-(3-methoxyphenyl)pyrrolidine;hydrochloride (CAS 1381929-36-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (2S)-2-(3-methoxyphenyl)pyrrolidine;hydrochloride. InChIKey: UQQGPFCOCRKQGR-MERQFXBCSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (2S)-2-(3-methoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | UQQGPFCOCRKQGR-MERQFXBCSA-N |
| SMILES | COC1=CC=CC(=C1)[C@@H]2CCCN2.Cl |
Computed by PubChem (NCBI)