Products 1313254-52-2

CAS 1313254-52-2 is the registry number for t-Butyl Z-DL-Alaninamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[1-(tert-butylamino)-1-oxopropan-2-yl]carbamate (CAS 1313254-52-2) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: benzyl N-[1-(tert-butylamino)-1-oxopropan-2-yl]carbamate. InChIKey: YPUQFTVEQMBYMB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O3
Molecular weight278.35 g/mol
IUPAC namebenzyl N-[1-(tert-butylamino)-1-oxopropan-2-yl]carbamate
InChIKeyYPUQFTVEQMBYMB-UHFFFAOYSA-N
SMILESCC(C(=O)NC(C)(C)C)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)