CAS 1381930-98-8 is the registry number for 3-Hydroxylicochalcone A. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
(E)-3-[3,4-dihydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one (CAS 1381930-98-8) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: (E)-3-[3,4-dihydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: WECAUVIWKBEGRA-DHZHZOJOSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (E)-3-[3,4-dihydroxy-2-methoxy-5-(2-methylbut-3-en-2-yl)phenyl]-1-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | WECAUVIWKBEGRA-DHZHZOJOSA-N |
| SMILES | CC(C)(C=C)C1=C(C(=C(C(=C1)/C=C/C(=O)C2=CC=C(C=C2)O)OC)O)O |
Computed by PubChem (NCBI)