CAS 1381944-20-2 appears in our catalog under these names: 4-Methoxy-3-(3-methoxyphenyl)-5-nitrobenzoic acid, 98%, 3',6-Dimethoxy-5-nitro-(1,1'-biphenyl)-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoic acid (CAS 1381944-20-2) is a chemical compound with the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. IUPAC name: 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoic acid. InChIKey: PGSQOXHXJIJTGB-UHFFFAOYSA-N.
| Molecular formula | C15H13NO6 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | 4-methoxy-3-(3-methoxyphenyl)-5-nitrobenzoic acid |
| InChIKey | PGSQOXHXJIJTGB-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=C(C(=CC(=C2)C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)