CAS 60547-92-4 appears in our catalog under these names: 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid, 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid 98%, 4-(Benzyloxy)-5-methoxy-2-nitrobenzoic acid, 98%, Benzoic acid, 5-methoxy-2-nitro-4-(phenylmethoxy)-, 98%, 98%. Offered by: Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 2,5g, 0,25g, 1000g, 250mg, 1g, 5g, 10g, 25g.
5-methoxy-2-nitro-4-phenylmethoxybenzoic acid (CAS 60547-92-4) is a chemical compound with the molecular formula C15H13NO6 and a molecular weight of 303.27 g/mol. IUPAC name: 5-methoxy-2-nitro-4-phenylmethoxybenzoic acid. InChIKey: VTHHRADLOLKTLD-UHFFFAOYSA-N.
| Molecular formula | C15H13NO6 |
|---|---|
| Molecular weight | 303.27 g/mol |
| IUPAC name | 5-methoxy-2-nitro-4-phenylmethoxybenzoic acid |
| InChIKey | VTHHRADLOLKTLD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)