CAS 1381944-57-5 is the registry number for 2-(3-Fluorophenyl)-2-methylpropan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 1g, 5g, on request.
2-(3-fluorophenyl)-2-methylpropan-1-amine;hydrochloride (CAS 1381944-57-5) is a chemical compound with the molecular formula C10H15ClFN and a molecular weight of 203.68 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-methylpropan-1-amine;hydrochloride. InChIKey: FTBGXTIPEHEJNY-UHFFFAOYSA-N.
| Molecular formula | C10H15ClFN |
|---|---|
| Molecular weight | 203.68 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | FTBGXTIPEHEJNY-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC(=CC=C1)F.Cl |
Computed by PubChem (NCBI)