CAS 2413-54-9 appears in our catalog under these names: 1-(4-Fluorophenyl)-2-methylpropan-2-amine hydrochloride, 95%, 1-(4-Fluorophenyl)-2-methylpropan-2-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
1-(4-fluorophenyl)-2-methylpropan-2-amine;hydrochloride (CAS 2413-54-9) is a chemical compound with the molecular formula C10H15ClFN and a molecular weight of 203.68 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-methylpropan-2-amine;hydrochloride. InChIKey: WXNVDQWUGUEUMO-UHFFFAOYSA-N.
| Molecular formula | C10H15ClFN |
|---|---|
| Molecular weight | 203.68 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-methylpropan-2-amine;hydrochloride |
| InChIKey | WXNVDQWUGUEUMO-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)