Products 13821-57-3

CAS 13821-57-3 is the registry number for 2,2'-(Butane-1,4-diylbis(sulfanediyl))diacetic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(carboxymethylsulfanyl)butylsulfanyl]acetic acid (CAS 13821-57-3) is a chemical compound with the molecular formula C8H14O4S2 and a molecular weight of 238.3 g/mol. IUPAC name: 2-[4-(carboxymethylsulfanyl)butylsulfanyl]acetic acid. InChIKey: YYQVDRBXQVJUHE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14O4S2
Molecular weight238.3 g/mol
IUPAC name2-[4-(carboxymethylsulfanyl)butylsulfanyl]acetic acid
InChIKeyYYQVDRBXQVJUHE-UHFFFAOYSA-N
SMILESC(CCSCC(=O)O)CSCC(=O)O

Computed by PubChem (NCBI)