CAS 65134-74-9 appears in our catalog under these names: (2S,2'S)-3,3'-Disulfanediylbis(2-methylpropanoic acid), 98%, Captopril EP Impurity N, Captopril Impurity 13（Captopril EP Impurity N）, 3,3'-Disulfanediylbis((2S)-2-methylpropanoic) Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
(2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid (CAS 65134-74-9) is a chemical compound with the molecular formula C8H14O4S2 and a molecular weight of 238.3 g/mol. IUPAC name: (2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid. InChIKey: AQLWLHRHIFTILV-PHDIDXHHSA-N.
| Molecular formula | C8H14O4S2 |
|---|---|
| Molecular weight | 238.3 g/mol |
| IUPAC name | (2S)-3-[[(2S)-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid |
| InChIKey | AQLWLHRHIFTILV-PHDIDXHHSA-N |
| SMILES | C[C@H](CSSC[C@@H](C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)