CAS 1382106-64-0 appears in our catalog under these names: 4-Chloro-2-fluorobenzoic acid sodium salt, 96%, Sodium 4-chloro-2-fluorobenzoate, 98%, 4-Chloro-2-fluorobenzoic acid sodium salt, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
Sodium 4-chloro-2-fluorobenzoate (CAS 1382106-64-0) is a chemical compound with the molecular formula C7H3ClFNaO2 and a molecular weight of 196.54 g/mol. IUPAC name: sodium 4-chloro-2-fluorobenzoate. InChIKey: LTDKNRAWRKPQGT-UHFFFAOYSA-M.
| Molecular formula | C7H3ClFNaO2 |
|---|---|
| Molecular weight | 196.54 g/mol |
| IUPAC name | sodium 4-chloro-2-fluorobenzoate |
| InChIKey | LTDKNRAWRKPQGT-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)