CAS 1382106-83-3 appears in our catalog under these names: Sodium 2-chloro-3-fluorobenzoate, 97%, 2-Chloro-3-fluorobenzoic acid sodium salt, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 100g, 1g, 5g.
Sodium 2-chloro-3-fluorobenzoate (CAS 1382106-83-3) is a chemical compound with the molecular formula C7H3ClFNaO2 and a molecular weight of 196.54 g/mol. IUPAC name: sodium 2-chloro-3-fluorobenzoate. InChIKey: VQPUHCKEZKWLMI-UHFFFAOYSA-M.
| Molecular formula | C7H3ClFNaO2 |
|---|---|
| Molecular weight | 196.54 g/mol |
| IUPAC name | sodium 2-chloro-3-fluorobenzoate |
| InChIKey | VQPUHCKEZKWLMI-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)