CAS 1382451-66-2 appears in our catalog under these names: {6,8-Dibromoimidazo(1,2-a)pyrazin-2-yl}methanol, (6,8-Dibromoimidazo(1,2-a)pyrazin-2-yl)methanol, 98+%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
(6,8-dibromoimidazo[1,2-a]pyrazin-2-yl)methanol (CAS 1382451-66-2) is a chemical compound with the molecular formula C7H5Br2N3O and a molecular weight of 306.94 g/mol. IUPAC name: (6,8-dibromoimidazo[1,2-a]pyrazin-2-yl)methanol. InChIKey: YYMYQOUCEBQSNQ-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2N3O |
|---|---|
| Molecular weight | 306.94 g/mol |
| IUPAC name | (6,8-dibromoimidazo[1,2-a]pyrazin-2-yl)methanol |
| InChIKey | YYMYQOUCEBQSNQ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2N1C=C(N=C2Br)Br)CO |
Computed by PubChem (NCBI)