CAS 1934625-19-0 is the registry number for 3,7-Dibromo-4-methoxy-1h-pyrazolo[4,3-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
3,7-dibromo-4-methoxy-2H-pyrazolo[4,3-c]pyridine (CAS 1934625-19-0) is a chemical compound with the molecular formula C7H5Br2N3O and a molecular weight of 306.94 g/mol. IUPAC name: 3,7-dibromo-4-methoxy-2H-pyrazolo[4,3-c]pyridine. InChIKey: GCIOMQVVVZDNMI-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2N3O |
|---|---|
| Molecular weight | 306.94 g/mol |
| IUPAC name | 3,7-dibromo-4-methoxy-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | GCIOMQVVVZDNMI-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C2=NNC(=C21)Br)Br |
Computed by PubChem (NCBI)