Products 1382764-52-4
CAS 1382764-52-4 appears in our catalog under these names: LipidGreen 2, LipidGreen 2, 99.00%, LipidGreen2 1PC X 5MG, LipidGreen 2, 98%. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 10mg, 25mg, 25 mg, 10 mg, 5 mg, 100 mg, 50 mg, 5MG.
Ethyl 5-methoxy-1,2-bis(3-methylbut-2-enyl)-3-oxoindole-2-carboxylate (CAS 1382764-52-4) is a chemical compound with the molecular formula C22H29NO4 and a molecular weight of 371.5 g/mol. IUPAC name: ethyl 5-methoxy-1,2-bis(3-methylbut-2-enyl)-3-oxoindole-2-carboxylate. InChIKey: VFAFYBVPGKPJDO-UHFFFAOYSA-N.
| Molecular formula | C22H29NO4 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | ethyl 5-methoxy-1,2-bis(3-methylbut-2-enyl)-3-oxoindole-2-carboxylate |
| InChIKey | VFAFYBVPGKPJDO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)C2=C(N1CC=C(C)C)C=CC(=C2)OC)CC=C(C)C |
Computed by PubChem (NCBI)