Products 1584236-34-9
CAS 1584236-34-9 is the registry number for Demethyl calyciphylline A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-17-carboxylic acid (CAS 1584236-34-9) is a chemical compound with the molecular formula C22H29NO4 and a molecular weight of 371.5 g/mol. IUPAC name: 2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-17-carboxylic acid. InChIKey: RYVGXCFPXHFNSQ-UHFFFAOYSA-N.
| Molecular formula | C22H29NO4 |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-13(19)-ene-17-carboxylic acid |
| InChIKey | RYVGXCFPXHFNSQ-UHFFFAOYSA-N |
| SMILES | CC1C[N+]2(CC3CCC4=C5C(CC4)C(CC56C3(C2CC1C6=O)C)C(=O)O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Demethyl calyciphylline A