CAS 1383373-65-6 appears in our catalog under these names: N-(2-(5-Chloro-1H-indol-3-yl)ethyl)-4'-cyanobiphenyl-2-carboxaMide/ 98.65% (existing batch purity), N-[2-(5-Chloro-1H-indol-3-yl)ethyl]-4′-cyano[1,1′-biphenyl]-2-carboxamide, 95%, 95%, TAU-IN-1, 98.61%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-cyanophenyl)benzamide (CAS 1383373-65-6) is a chemical compound with the molecular formula C24H18ClN3O and a molecular weight of 399.9 g/mol. IUPAC name: N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-cyanophenyl)benzamide. InChIKey: FCSWXUCDKVWJEN-UHFFFAOYSA-N.
| Molecular formula | C24H18ClN3O |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-(4-cyanophenyl)benzamide |
| InChIKey | FCSWXUCDKVWJEN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C#N)C(=O)NCCC3=CNC4=C3C=C(C=C4)Cl |
Computed by PubChem (NCBI)