Products 939655-35-3
CAS 939655-35-3 is the registry number for Antiviral agent 58. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-chlorophenyl)-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one (CAS 939655-35-3) is a chemical compound with the molecular formula C24H18ClN3O and a molecular weight of 399.9 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one. InChIKey: ZVSOLFXHDNDGHL-UHFFFAOYSA-N.
| Molecular formula | C24H18ClN3O |
|---|---|
| Molecular weight | 399.9 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-b]pyridin-6-one |
| InChIKey | ZVSOLFXHDNDGHL-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(NC1=O)N(N=C2C3=CC=C(C=C3)Cl)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
Antiviral agent 58, orb2664532