Products 1383539-73-8
CAS 1383539-73-8 appears in our catalog under these names: HJC0197/ 99.76% (existing batch purity), HJC0197, HJC0197, ≥98%, ≥98%, HJC0197, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
4-cyclopentyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile (CAS 1383539-73-8) is a chemical compound with the molecular formula C19H21N3OS and a molecular weight of 339.5 g/mol. IUPAC name: 4-cyclopentyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile. InChIKey: QLLWRTHDHRGHQZ-UHFFFAOYSA-N.
| Molecular formula | C19H21N3OS |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | 4-cyclopentyl-2-[(2,5-dimethylphenyl)methylsulfanyl]-6-oxo-1H-pyrimidine-5-carbonitrile |
| InChIKey | QLLWRTHDHRGHQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CSC2=NC(=C(C(=O)N2)C#N)C3CCCC3 |
Computed by PubChem (NCBI)
Synonyms:
orb1219952, orb1308228