Products 728907-99-1

CAS 728907-99-1 is the registry number for 5-Butoxy-5,6-diphenyl-2,3,4,5-tetrahydro-1,2,4-triazine-3-thione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-butoxy-5,6-diphenyl-2,4-dihydro-1,2,4-triazine-3-thione (CAS 728907-99-1) is a chemical compound with the molecular formula C19H21N3OS and a molecular weight of 339.5 g/mol. IUPAC name: 5-butoxy-5,6-diphenyl-2,4-dihydro-1,2,4-triazine-3-thione. InChIKey: UQRJGJSZFBDWCL-UHFFFAOYSA-N.

Identity
Molecular formulaC19H21N3OS
Molecular weight339.5 g/mol
IUPAC name5-butoxy-5,6-diphenyl-2,4-dihydro-1,2,4-triazine-3-thione
InChIKeyUQRJGJSZFBDWCL-UHFFFAOYSA-N
SMILESCCCCOC1(C(=NNC(=S)N1)C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)