Products 1383685-15-1
CAS 1383685-15-1 is the registry number for 4-(Bis(4-chlorophenyl)amino)phenol, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-(4-chloro-N-(4-chlorophenyl)anilino)phenol (CAS 1383685-15-1) is a chemical compound with the molecular formula C18H13Cl2NO and a molecular weight of 330.2 g/mol. IUPAC name: 4-(4-chloro-N-(4-chlorophenyl)anilino)phenol. InChIKey: YHKGWGUHJFHCRQ-UHFFFAOYSA-N.
| Molecular formula | C18H13Cl2NO |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 4-(4-chloro-N-(4-chlorophenyl)anilino)phenol |
| InChIKey | YHKGWGUHJFHCRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)