Products 138371-64-9
CAS 138371-64-9 is the registry number for 2-Benzoylpyrrolidine Hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Phenyl(pyrrolidin-2-yl)methanone;hydrochloride (CAS 138371-64-9) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: phenyl(pyrrolidin-2-yl)methanone;hydrochloride. InChIKey: SDXIWJXHEFXGNL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | phenyl(pyrrolidin-2-yl)methanone;hydrochloride |
| InChIKey | SDXIWJXHEFXGNL-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)