CAS 1383798-19-3 is the registry number for 2-Methyl-4'-(trifluoromethyl)biphenyl-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-methyl-4-[4-(trifluoromethyl)phenyl]benzonitrile (CAS 1383798-19-3) is a chemical compound with the molecular formula C15H10F3N and a molecular weight of 261.24 g/mol. IUPAC name: 3-methyl-4-[4-(trifluoromethyl)phenyl]benzonitrile. InChIKey: VBRUIEVESWEEMK-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 3-methyl-4-[4-(trifluoromethyl)phenyl]benzonitrile |
| InChIKey | VBRUIEVESWEEMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)