Products 847237-13-2
CAS 847237-13-2 is the registry number for 2-[3-(trifluoromethyl)phenyl]-1H-indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
2-[3-(trifluoromethyl)phenyl]-1H-indole (CAS 847237-13-2) is a chemical compound with the molecular formula C15H10F3N and a molecular weight of 261.24 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1H-indole. InChIKey: FVOVGGDWCKGEBL-UHFFFAOYSA-N.
| Molecular formula | C15H10F3N |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1H-indole |
| InChIKey | FVOVGGDWCKGEBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)