Products 138405-05-7
CAS 138405-05-7 appears in our catalog under these names: (2R,3R)-Rel-1,2,3,4-butanetetracarboxylic acid, 2,3-dimethyl ester, 95%, (3S,4S)-3,4-Bis(methoxycarbonyl)hexanedioic acid, 95%, (3R,4R)-rel-3,4-Bis(methoxycarbonyl)hexanedioic acid, 98+%, (2r,3r)-Rel-1,2,3,4-Butanetetracarboxylic Acid 2,3-Dimethyl Ester. Offered by: Combi-blocks, AmBeed, TRC. Available pack sizes: 100g, 10g, 1g, 25g, 5g, 250mg.
(3S,4S)-3,4-bis(methoxycarbonyl)hexanedioic acid (CAS 138405-05-7) is a chemical compound with the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. IUPAC name: (3S,4S)-3,4-bis(methoxycarbonyl)hexanedioic acid. InChIKey: FKFVPINWMGATEI-WDSKDSINSA-N.
| Molecular formula | C10H14O8 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | (3S,4S)-3,4-bis(methoxycarbonyl)hexanedioic acid |
| InChIKey | FKFVPINWMGATEI-WDSKDSINSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)O)[C@H](CC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
(2r,3r)-rel-1,2,3,4-butanetetracarboxylic acid, 2,3-dimethyl ester, (3S,4S)-3,4-bis(methoxycarbonyl)hexanedioic Acid, 2,3-Dimethyl (2R,3R)-rel-1,2,3,4-Butanetetracarboxylate, (2r,3r)-Rel-1,2,3,4-Butanetetracarboxylic Acid 2,3-Dimethyl Ester, 1,2,3,4-Butanetetracarboxylic acid, 2,3-dimethyl ester, (2S,3S)-