CAS 1446476-53-4 is the registry number for (3R,4R)-3,4-Bis(methoxycarbonyl)hexanedioic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-3,4-bis(methoxycarbonyl)hexanedioic acid (CAS 1446476-53-4) is a chemical compound with the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. IUPAC name: (3R,4R)-3,4-bis(methoxycarbonyl)hexanedioic acid. InChIKey: FKFVPINWMGATEI-PHDIDXHHSA-N.
| Molecular formula | C10H14O8 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | (3R,4R)-3,4-bis(methoxycarbonyl)hexanedioic acid |
| InChIKey | FKFVPINWMGATEI-PHDIDXHHSA-N |
| SMILES | COC(=O)[C@H](CC(=O)O)[C@@H](CC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)