Products 1384079-66-6
CAS 1384079-66-6 is the registry number for 2-Amino-1-(4-(trifluoromethoxy)phenyl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-[4-(trifluoromethoxy)phenyl]ethanol;hydrochloride (CAS 1384079-66-6) is a chemical compound with the molecular formula C9H11ClF3NO2 and a molecular weight of 257.64 g/mol. IUPAC name: 2-amino-1-[4-(trifluoromethoxy)phenyl]ethanol;hydrochloride. InChIKey: YXXPEUQKZISRQV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO2 |
|---|---|
| Molecular weight | 257.64 g/mol |
| IUPAC name | 2-amino-1-[4-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
| InChIKey | YXXPEUQKZISRQV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN)O)OC(F)(F)F.Cl |
Computed by PubChem (NCBI)