CAS 1391469-99-0 appears in our catalog under these names: (R)-2-Amino-2-(3-(trifluoromethoxy)phenyl)ethan-1-ol hydrochloride, 98%, 98%, (R)-2-Amino-2-(3-(trifluoromethoxy)phenyl)ethan-1-ol hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
(2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride (CAS 1391469-99-0) is a chemical compound with the molecular formula C9H11ClF3NO2 and a molecular weight of 257.64 g/mol. IUPAC name: (2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride. InChIKey: XPBLGMPQLWNYOC-QRPNPIFTSA-N.
| Molecular formula | C9H11ClF3NO2 |
|---|---|
| Molecular weight | 257.64 g/mol |
| IUPAC name | (2R)-2-amino-2-[3-(trifluoromethoxy)phenyl]ethanol;hydrochloride |
| InChIKey | XPBLGMPQLWNYOC-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)