CAS 1384268-80-7 is the registry number for (S)-Ethyl 2-amino-2-(6-fluoro-1H-indol-3-yl)acetate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl (2S)-2-amino-2-(6-fluoro-1H-indol-3-yl)acetate;hydrochloride (CAS 1384268-80-7) is a chemical compound with the molecular formula C12H14ClFN2O2 and a molecular weight of 272.70 g/mol. IUPAC name: ethyl (2S)-2-amino-2-(6-fluoro-1H-indol-3-yl)acetate;hydrochloride. InChIKey: ZNXWWFUSCAHWTA-MERQFXBCSA-N.
| Molecular formula | C12H14ClFN2O2 |
|---|---|
| Molecular weight | 272.70 g/mol |
| IUPAC name | ethyl (2S)-2-amino-2-(6-fluoro-1H-indol-3-yl)acetate;hydrochloride |
| InChIKey | ZNXWWFUSCAHWTA-MERQFXBCSA-N |
| SMILES | CCOC(=O)[C@H](C1=CNC2=C1C=CC(=C2)F)N.Cl |
Computed by PubChem (NCBI)