CAS 1384427-36-4 appears in our catalog under these names: 4-aminobicyclo(2.2.1)heptane-1-carboxylic acid hydrochloride, 4-Aminobicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride, 97%, 4-Aminobicyclo(2.2.1)heptane-1-carboxylic acid hydrochloride, 97%, 4–aminobicyclo(2·2·1)heptane–1–carboxylic acid hydrochloride, Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-amino-, hydrochloride (1:1), 97%, 97%. Offered by: Biosynth, Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 0,5g, 50mg, 250mg, 1g, 5g, 100mg, 500mg.
4-aminobicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride (CAS 1384427-36-4) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: 4-aminobicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride. InChIKey: LQJXNKWRMYPICI-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 4-aminobicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | LQJXNKWRMYPICI-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)