Products 1384428-27-6
CAS 1384428-27-6 is the registry number for 1-{(3-(Chloromethyl)phenyl)sulfanyl}-N,N-dimethylformamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
S-[3-(chloromethyl)phenyl] N,N-dimethylcarbamothioate (CAS 1384428-27-6) is a chemical compound with the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. IUPAC name: S-[3-(chloromethyl)phenyl] N,N-dimethylcarbamothioate. InChIKey: GNNGBUGMUNAQQS-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNOS |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | S-[3-(chloromethyl)phenyl] N,N-dimethylcarbamothioate |
| InChIKey | GNNGBUGMUNAQQS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=CC=CC(=C1)CCl |
Computed by PubChem (NCBI)