CAS 1384428-65-2 is the registry number for 5-​fluoro-​7-​methyl-​1,​2-​benzisothiazol-​3(2H)​-​one 1,​1-​dioxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-fluoro-7-methyl-1,1-dioxo-1,2-benzothiazol-3-one (CAS 1384428-65-2) is a chemical compound with the molecular formula C8H6FNO3S and a molecular weight of 215.20 g/mol. IUPAC name: 5-fluoro-7-methyl-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: CHVWSACHVSYRPT-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO3S |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 5-fluoro-7-methyl-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | CHVWSACHVSYRPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1S(=O)(=O)NC2=O)F |
Computed by PubChem (NCBI)