CAS 1708370-70-0 appears in our catalog under these names: 6-Fluoro-1H-benzo(c)(1,2)thiazin-4(3H)-one 2,2-dioxide, 95%, 6-​Fluoro-1H-​2,​1-​benzothiazin-​4(3H)​-​one 2,​2-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-fluoro-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one (CAS 1708370-70-0) is a chemical compound with the molecular formula C8H6FNO3S and a molecular weight of 215.20 g/mol. IUPAC name: 6-fluoro-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one. InChIKey: ICAASDMWLZKUBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO3S |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 6-fluoro-2,2-dioxo-1H-2lambda6,1-benzothiazin-4-one |
| InChIKey | ICAASDMWLZKUBJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C=CC(=C2)F)NS1(=O)=O |
Computed by PubChem (NCBI)