CAS 1384429-37-1 is the registry number for 3-(3-Aminopyridin-2-yl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(3-amino-2-pyridinyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one (CAS 1384429-37-1) is a chemical compound with the molecular formula C9H8F3N3O2 and a molecular weight of 247.17 g/mol. IUPAC name: 3-(3-amino-2-pyridinyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one. InChIKey: IXFZGYGANBMQJA-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N3O2 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 3-(3-amino-2-pyridinyl)-5-(trifluoromethyl)-1,3-oxazolidin-2-one |
| InChIKey | IXFZGYGANBMQJA-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=C(C=CC=N2)N)C(F)(F)F |
Computed by PubChem (NCBI)