CAS 158062-96-5 appears in our catalog under these names: N-Descyanomethyl-N-acetamide Flonicamid, >95% (HPLC), Flonicamid-acetamide, TFNG-AM, TFNG-AM, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 10mg, 1x10mg, 1x1ml.
N-(2-amino-2-oxoethyl)-4-(trifluoromethyl)pyridine-3-carboxamide (CAS 158062-96-5) is a chemical compound with the molecular formula C9H8F3N3O2 and a molecular weight of 247.17 g/mol. IUPAC name: N-(2-amino-2-oxoethyl)-4-(trifluoromethyl)pyridine-3-carboxamide. InChIKey: FZAQQBPOTJCLJM-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N3O2 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | N-(2-amino-2-oxoethyl)-4-(trifluoromethyl)pyridine-3-carboxamide |
| InChIKey | FZAQQBPOTJCLJM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)C(=O)NCC(=O)N |
Computed by PubChem (NCBI)