CAS 1384430-20-9 is the registry number for 4-Fluoro-2-(3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-fluoro-2-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]aniline (CAS 1384430-20-9) is a chemical compound with the molecular formula C16H14FN3O2 and a molecular weight of 299.30 g/mol. IUPAC name: 4-fluoro-2-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]aniline. InChIKey: RGHFECUBQNSNCA-UHFFFAOYSA-N.
| Molecular formula | C16H14FN3O2 |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | 4-fluoro-2-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]aniline |
| InChIKey | RGHFECUBQNSNCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCC2=NOC(=N2)C3=C(C=CC(=C3)F)N |
Computed by PubChem (NCBI)