CAS 2969160-15-2 is the registry number for Monoamine Oxidase B inhibitor 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[6-[(4-fluorophenyl)methoxy]-1H-benzimidazol-2-yl]acetamide (CAS 2969160-15-2) is a chemical compound with the molecular formula C16H14FN3O2 and a molecular weight of 299.30 g/mol. IUPAC name: 2-[6-[(4-fluorophenyl)methoxy]-1H-benzimidazol-2-yl]acetamide. InChIKey: AOGHVXHSPZUBKO-UHFFFAOYSA-N.
| Molecular formula | C16H14FN3O2 |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | 2-[6-[(4-fluorophenyl)methoxy]-1H-benzimidazol-2-yl]acetamide |
| InChIKey | AOGHVXHSPZUBKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC3=C(C=C2)N=C(N3)CC(=O)N)F |
Computed by PubChem (NCBI)