CAS 1384430-35-6 appears in our catalog under these names: 6-Bromo-8-hydrazinylimidazo(1,2-a)pyrazine, 6-Bromo-8-hydrazinylimidazo(1,2-a)pyrazine, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 10g.
(6-bromoimidazo[1,2-a]pyrazin-8-yl)hydrazine (CAS 1384430-35-6) is a chemical compound with the molecular formula C6H6BrN5 and a molecular weight of 228.05 g/mol. IUPAC name: (6-bromoimidazo[1,2-a]pyrazin-8-yl)hydrazine. InChIKey: LBMOONNIZAIUOP-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN5 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | (6-bromoimidazo[1,2-a]pyrazin-8-yl)hydrazine |
| InChIKey | LBMOONNIZAIUOP-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C(C2=N1)NN)Br |
Computed by PubChem (NCBI)