CAS 83255-87-2 is the registry number for 3-Bromo-1-methyl-1H-pyrazolo(3,4-d)pyrimidin-4-amine, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
3-bromo-1-methylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 83255-87-2) is a chemical compound with the molecular formula C6H6BrN5 and a molecular weight of 228.05 g/mol. IUPAC name: 3-bromo-1-methylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: DHFYKLULHRGVSL-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN5 |
|---|---|
| Molecular weight | 228.05 g/mol |
| IUPAC name | 3-bromo-1-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | DHFYKLULHRGVSL-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=NC(=C2C(=N1)Br)N |
Computed by PubChem (NCBI)