CAS 1384431-06-4 appears in our catalog under these names: 3-(Dimethylamino)-4-methylbenzene-1-sulfonyl chloride hydrochloride, 3-(Dimethylamino)-4-methylbenzene-1-sulfonyl chloride hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-(dimethylamino)-4-methylbenzenesulfonyl chloride;hydrochloride (CAS 1384431-06-4) is a chemical compound with the molecular formula C9H13Cl2NO2S and a molecular weight of 270.18 g/mol. IUPAC name: 3-(dimethylamino)-4-methylbenzenesulfonyl chloride;hydrochloride. InChIKey: YYJRWOULAPNWJV-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2NO2S |
|---|---|
| Molecular weight | 270.18 g/mol |
| IUPAC name | 3-(dimethylamino)-4-methylbenzenesulfonyl chloride;hydrochloride |
| InChIKey | YYJRWOULAPNWJV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)N(C)C.Cl |
Computed by PubChem (NCBI)