Products 259183-88-5

CAS 259183-88-5 is the registry number for 4-((Dimethylamino)methyl)benzene-1-sulfonyl chloride hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-[(dimethylamino)methyl]benzenesulfonyl chloride;hydrochloride (CAS 259183-88-5) is a chemical compound with the molecular formula C9H13Cl2NO2S and a molecular weight of 270.18 g/mol. IUPAC name: 4-[(dimethylamino)methyl]benzenesulfonyl chloride;hydrochloride. InChIKey: CTUYVPJOGGXYPO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13Cl2NO2S
Molecular weight270.18 g/mol
IUPAC name4-[(dimethylamino)methyl]benzenesulfonyl chloride;hydrochloride
InChIKeyCTUYVPJOGGXYPO-UHFFFAOYSA-N
SMILESCN(C)CC1=CC=C(C=C1)S(=O)(=O)Cl.Cl

Computed by PubChem (NCBI)