Products 1384573-25-4
CAS 1384573-25-4 appears in our catalog under these names: (3-([2,2':6',2''-Terpyridin]-4'-yl)phenyl)boronic acid, 96%, 96%, (3-([2,2':6',2''-Terpyridin]-4'-yl)phenyl)boronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
[3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]boronic acid (CAS 1384573-25-4) is a chemical compound with the molecular formula C21H16BN3O2 and a molecular weight of 353.2 g/mol. IUPAC name: [3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]boronic acid. InChIKey: OESBJWJZTPVJDM-UHFFFAOYSA-N.
| Molecular formula | C21H16BN3O2 |
|---|---|
| Molecular weight | 353.2 g/mol |
| IUPAC name | [3-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]boronic acid |
| InChIKey | OESBJWJZTPVJDM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4)(O)O |
Computed by PubChem (NCBI)