CAS 13846-08-7 is the registry number for 2-Naphthol-6,8-disulfonic Acid Potassium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 2,5g.
Dipotassium;7-hydroxynaphthalene-1,3-disulfonate (CAS 13846-08-7) is a chemical compound with the molecular formula C10H6K2O7S2 and a molecular weight of 380.5 g/mol. IUPAC name: dipotassium;7-hydroxynaphthalene-1,3-disulfonate. InChIKey: LKDMVWRBMGEEGR-UHFFFAOYSA-L.
| Molecular formula | C10H6K2O7S2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | dipotassium;7-hydroxynaphthalene-1,3-disulfonate |
| InChIKey | LKDMVWRBMGEEGR-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[K+].[K+] |
Computed by PubChem (NCBI)