CAS 842-18-2 appears in our catalog under these names: Dipotassium 2-Naphthol-6,8-disulfonate, Dipotassium 2–Naphthol–6,8–disulfonate Hydrate, Dipotassium 2-naphthol-6,8-disulfonate hydrate, 2-Naphthol-6,8-disulfonic acid dipotassium salt, 2-Naphthol-6,8-disulfonic acid dipotassium salt, 98%. Offered by: Fluorochem, GLPBio, Biosynth, Chemat, Combi-blocks. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 0,5kg, 0,1kg, 1kg.
Dipotassium;7-hydroxynaphthalene-1,3-disulfonate (CAS 842-18-2) is a chemical compound with the molecular formula C10H6K2O7S2 and a molecular weight of 380.5 g/mol. IUPAC name: dipotassium;7-hydroxynaphthalene-1,3-disulfonate. InChIKey: LKDMVWRBMGEEGR-UHFFFAOYSA-L.
| Molecular formula | C10H6K2O7S2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | dipotassium;7-hydroxynaphthalene-1,3-disulfonate |
| InChIKey | LKDMVWRBMGEEGR-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[K+].[K+] |
Computed by PubChem (NCBI)